A common application of CXSMILES is the use of R-groups.
This is done with the following CXSMILES pattern like
[NH3+]CCOP([O-])(=O)OC[C@@H](CO\C=C/[*])OC([*])=O |$;;;;;;;;;;;;;;R;;;R$|:
If you want the R-groups numbers, that is possible too. The same compound as in the previous example
can have have numbered R-groups with a CXSMILES like [NH3+]CCOP([O-])(=O)OC[C@@H](CO\C=C/[*])OC([*])=O |$;;;;;;;;;;;;;;R1;;;R2$|:
If we have a single tail lipid with x+y+2 carbons in the tail but we do not
know the location of the double bond, we can use a CxSMILES like
[H]C\\C=C\\CC(=O)O |Sg:n:1:x:ht,Sg:n:4:y:ht| x+y=15:
If we have a single tail lipid with x+y+z+4 carbons in the tail but we do not
know the location of the double bonds, we can use a CxSMILES like
[H]CC=CCC=CCC(=O)O |Sg:n:1:x:ht,Sg:n:4:y:ht,Sg:n:7:z:ht| x+y+z=15:
Sometimes experimental data does not provide enough information to decide how long
the individual lipid tails are, but only provide the total length. Then a template like
OCC(OC(=O)C[H])COC(=O)C[H] |Sg:n:6:x:ht,Sg:n:12:y:ht| x+y=28 can be useful:
When it is knows that, for example, a ring has a hydrogen replace by another atom
but the exact position is not known, CxSMILES allows you to indicate what the possible
locations are. For example, monochlorobiphenyl can be represented with the
CxSMILES Cl*.c1ccccc1-c1ccccc1 |m:1:3.4.5.6.7.8.9|:
Or for a flavonoid with known number of hydroxy groups on each rings, but with position uncertainty:
O*.O*.C1=C(C(=C2C(=C1)OC(=CC2=O)C3=CC(=C(C=C3)))).O* |m:3:4.5,m:1:8.9,m:22:18.19|
Polymers can be defined as a repeating unit started with Sg:n: followed by the
atom indices (starting at 0) of the atoms in the monomer unit: [*]c1Nc(cc1)c1Nc(cc1)[*] |Sg:n:1,2,3,4,5,6,7,8,9,10::ht|.
This gives this polymer template:
Similarly, co-polymers can be represented with something like, here a block polymer:
[*]C(=O)CC(C)OC(=O)CC(CC)O[*] |Sg:n:1,2,3,4,5,6:m:ht,Sg:n:7,8,9,10,11,12,13:n:ht|:
Wikidata has multiple CXSMILES for polymers. You can list these with this SPARQL query.
Another useful option is using CXSMILES for functionality groups, using the _AP instruction.
For example, an hydroxyl functional group can be representated as *O |$_AP1$|: